Name | Value |
---|---|
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) | |
RHGKLRLOHDJJDR-UHFFFAOYSA-N | |
C6H13N3O3 | |
175.09569127599997 | |
O=C(O)C(N)CCCNC(=N)O |
External Identifier | Value |
---|---|
372-75-8 | |
810 | |
833 |
Name | Value |
---|---|
BML01052 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 0.050 | |
175.095691 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
10 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
0.6 ml/min | |
0.364 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
positive | |
1.4456738221868486 | |
0.8982476497030095 | |
176.103 | |
[M+H]+ | |
3.7550524406727783 ppm | |
-6.612759999597984E-4 Da |