| Name | Value |
|---|---|
| 62388 | |
| C13H20O3 | |
| 224.14124449999997 | |
| O=C(OC)CC1CCC(=O)C1CC=CCC | |
| InChI=1S/C13H20O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h4-5,10-11H,3,6-9H2,1-2H3/b5-4+ | |
| GEWDNTWNSAZUDX-SNAWJCMRSA-N |
| Name | Value |
|---|---|
| 051102bylcs15 for spec, 051102bylcs16 for RI | |
| 585533 | |
| major | |
| 1 MEOX | |
| 253.168 | |
| MS1 | |
| Leco Pegasus IV | |
| GC-EI-TOF | |
| 250C | |
| 230C | |
| -70 eV | |
| 80-500 Da | |
| Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
| 10m | |
| helium | |
| 50-330°C | |
| 1 mL min-1 | |
| 0.5 µL | |
| 25 splitless time into a multi-baffled glass liner | |
| 50°C ramped to 250°C by 12°C s-1 | |
| 50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
| 1800 V | |
| positive | |
| 3.8662034250689468 | |
| 0.7869886069739014 |