Name | Value |
---|---|
5408 | |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3 | |
MUMGGOZAMZWBJJ-UHFFFAOYSA-N | |
C19H28O2 | |
288.208930136 | |
O=C1C=C2CCC3C(CCC4(C)C(O)CCC34)C2(C)CC1 |
Name | Value |
---|---|
1800 V | |
peak 2 | |
060123bylcs42 | |
960032 | |
1 TMS; 1 MEOX | |
389.275 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
positive | |
4.5465189222790805 | |
0.8252311589750413 |