| Name | Value |
|---|---|
| 169019 | |
| InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4-/m1/s1 | |
| UNXHWFMMPAWVPI-QWWZWVQMSA-N | |
| C4H10O4 | |
| 122.05790879999999 | |
| OCC(O)C(O)CO |
| Name | Value |
|---|---|
| 060123bylcs45 | |
| 466960 | |
| 4 TMS | |
| 410.216 | |
| MS1 | |
| Leco Pegasus IV | |
| GC-EI-TOF | |
| 250C | |
| 230C | |
| -70 eV | |
| 80-500 Da | |
| Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
| 10m | |
| helium | |
| 50-330°C | |
| 1 mL min-1 | |
| 0.5 µL | |
| 25 splitless time into a multi-baffled glass liner | |
| 50°C ramped to 250°C by 12°C s-1 | |
| 50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
| 1800 V | |
| positive | |
| 3.2408452932798806 | |
| 0.6842714317383558 |