Name | Value |
---|---|
17106 | |
InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3+,4+,5-,6?/m0/s1 | |
SHZGCJCMOBCMKK-DHVFOXMCSA-N | |
C6H12O5 | |
164.06847348399998 | |
OC1OC(C)C(O)C(O)C1O |
Name | Value |
---|---|
060125bylqc05 | |
584581 | |
peak 2 | |
4 TMS; 1 MEOX | |
481.253 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
10m | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
2.594978340214354 | |
0.6048252817231569 |