Name | Value |
---|---|
7405 | |
InChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1 | |
ODHCTXKNWHHXJC-VKHMYHEASA-N | |
C5H7NO3 | |
129.04259308399998 | |
O=C(O)C1N=C(O)CC1 |
Name | Value |
---|---|
-70 eV | |
060121bylcs01 | |
485159 | |
2 TMS | |
273.122 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
2.272388300837913 | |
0.5348689762782397 |