Name | Value |
---|---|
35717 | |
InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8?/m1/s1 | |
OVRNDRQMDRJTHS-KEWYIRBNSA-N | |
C8H15NO6 | |
221.08993719999998 | |
OC(=NC1C(O)OC(CO)C(O)C1O)C |
Name | Value |
---|---|
060102bylcs13 | |
726136 | |
major | |
5 TMS | |
581.288 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
4.2919073286809475 | |
0.7756380311605231 |