| Name | Value |
|---|---|
| 6029 | |
| InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1 | |
| DRTQHJPVMGBUCF-XVFCMESISA-N | |
| C9H12N2O6 | |
| 244.06953610399998 | |
| O=C1N=C(O)C=CN1C2OC(CO)C(O)C2O |
| Name | Value |
|---|---|
| 051108bylcs28 | |
| 856628 | |
| minor | |
| 4 TMS | |
| 532.228 | |
| MS1 | |
| Leco Pegasus IV | |
| GC-EI-TOF | |
| 250C | |
| 230C | |
| -70 eV | |
| 80-500 Da | |
| Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
| 10m | |
| helium | |
| 50-330°C | |
| 1 mL min-1 | |
| 0.5 µL | |
| 25 splitless time into a multi-baffled glass liner | |
| 50°C ramped to 250°C by 12°C s-1 | |
| 50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
| 1800 V | |
| positive | |
| 4.314007130892043 | |
| 0.7470722352839143 |