Name | Value |
---|---|
77982 | |
InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 | |
PPQRONHOSHZGFQ-LMVFSUKVSA-N | |
C5H11O8P | |
230.019153942 | |
O=CC(O)C(O)C(O)COP(=O)(O)O |
Name | Value |
---|---|
major | |
070502bmplib5_1 | |
733259 | |
5 TMS; 1 MEOX | |
619.243 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
4.280466338522602 | |
0.7676659631106177 |