Name | Value |
---|---|
444899 | |
InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15- | |
YZXBAPSDXZZRGB-DOFZRALJSA-N | |
C20H32O2 | |
304.240230264 | |
O=C(O)CCCC=CCC=CCC=CCC=CCCCCC |
Name | Value |
---|---|
061108byusa16 | |
833984 | |
1 TMS | |
376.28 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
3.2776821416469013 | |
0.7714924826103455 |