Name | Value |
---|---|
MOYAFQVGZZPNRA-UHFFFAOYSA-N | |
11463 | |
C10H16 | |
136.125200512 | |
C1=C(C)CCC(=C(C)C)C1 | |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4H,5-7H2,1-3H3 |
Name | Value |
---|---|
49619 | |
445199 | |
1089 | |
136.1252 | |
MS1 | |
Leco Pegasus IV | |
GC-EI-TOF | |
250C | |
230C | |
-70 eV | |
80-500 Da | |
Restek Corporation Rtx-5Sil MS (30 m length x 0.25 mm internal diameter with 0.25 µm film made of 95% dimethyl/5%diphenylpolysiloxane) | |
10m | |
helium | |
50-330°C | |
1 mL min-1 | |
0.5 µL | |
25 splitless time into a multi-baffled glass liner | |
50°C ramped to 250°C by 12°C s-1 | |
50°C for 1 min, then ramped at 20°C min-1 to 330°C, held constant for 5 min. | |
1800 V | |
positive | |
3.357966142243581 | |
0.678546992908758 |