Name | Value |
---|---|
Natural Product | |
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 | |
HNDVDQJCIGZPNO-YFKPBYRVSA-N | |
C6H9N3O2 | |
155.069476528 | |
O=C(O)C(N)CC1=CN=CN1 |
Name | Value |
---|---|
KNA00085 | |
2016.01.19 (Created 2009.11.17, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] L-Histidine (exact mass = 155.06948) and L-Lysine (exact mass = 146.10553) and L-Arginine (exact mass = 174.11168) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
155.06948 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
4.003408 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
2.040831498930276 | |
0.4535372934519003 |