Name | Value |
---|---|
Natural Product | |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 | |
XUJNEKJLAYXESH-REOHCLBHSA-N | |
C3H7NO2S | |
121.019749464 | |
O=C(O)C(N)CS |
Name | Value |
---|---|
KNA00145 | |
2016.01.19 (Created 2009.11.17, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] L-Cysteine (exact mass = 121.01975) and Creatine (exact mass = 131.06948) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
121.01975 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
4.992053 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
1.2074093261681604 | |
0.33192597320058537 |