Name | Value |
---|---|
Natural Product | |
InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1 | |
ZJUKTBDSGOFHSH-WFMPWKQPSA-N | |
C14H20N6O5S | |
384.12158874 | |
O=C(O)C(N)CCSCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
Name | Value |
---|---|
KNA00312 | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
2016.01.19 (Created 2009.11.18, modified 2011.08.03) | |
CC BY-SA | |
[Spectral] S-Adenosyl-L-homocysteine (exact mass = 384.12159) and Adenosine (exact mass = 267.09675) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
384.12159 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
35eV | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.475050 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
positive | |
1.8541587276651508 | |
0.45860381302021785 |