Name | Value |
---|---|
Natural Product | |
InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) | |
FDGQSTZJBFJUBT-UHFFFAOYSA-N | |
C5H4N4O | |
136.038510748 | |
OC1=NC=NC=2NC=NC12 |
Name | Value |
---|---|
35eV | |
KNA00569 | |
2016.01.19 (Created 2009.11.18, modified 2011.08.03) | |
Takahashi H, Kanaya S, Ogasawara N, Graduate School of Information Science, NAIST | |
CC BY-SA | |
[Spectral] Hypoxanthine (exact mass = 136.03851) and Adenine (exact mass = 135.0545) were not completely separated on HPLC under the present analytical conditions as described in "AC$XXX". Additionally some of the peaks in this data contains dimers and other unidentified ions. | |
136.03851 | |
LTQ Orbitrap XL, Thermo Scientfic | |
LC-ESI-ITFT | |
MS1 | |
ESI | |
TOSOH TSKgel ODS-100V 5um Part no. 21456 | |
0min:3%, 45min:97%, 50min:97%, 50.1:3%, 57min:3% (acetonitrile) | |
0.5 ml/min | |
5.484573 min | |
0.1%formate-water / 0.1%formate-acetonitrile | |
negative | |
4.240864583186326 | |
0.6641715691306138 |