Name | Value |
---|---|
InChI=1S/C9H13N2O9P/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 | |
DJJCXFVJDGTHFX-XVFCMESISA-N | |
C9H13N2O9P | |
324.03586662600003 | |
O=C1N=C(O)C=CN1C2OC(COP(=O)(O)O)C(O)C2O |
Name | Value |
---|---|
0.28ml/min | |
9.02 | |
30 | |
C9H13N2O9P | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC pHILIC Guard column (2.1 mm x 20 mm, 5 µm particle size) with Merck SeQuant ZIC pHILIC (2.1 x 100 mm, 5 µm particle size, 100 Å) | |
12/88 at 0 min, 40/60 at 8.5 min, 75/25 at 8.7-11.2 min; 12/88 at 11.5-22 min | |
5 mM ammonium acetate in water with 0.04% NH4OH (pH 9.3) | |
acetonitrile | |
NEG_2020-11-24_V01B_RCH_LC06_tDDA_ChemSTD_219_CPD_Meister2020_OPEN.msp | |
negative | |
1.401890758261966 | |
0.8710437025444232 | |
323.028594970703 | |
[M-H]- | |
0.013449902083427142 ppm | |
4.344702972503001E-6 Da |