| Name | Value |
|---|---|
| InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) | |
| AEMRFAOFKBGASW-UHFFFAOYSA-N | |
| C2H4O3 | |
| 76.01604398799999 | |
| O=C(O)CO |
| Name | Value |
|---|---|
| 4.25 | |
| 10 | |
| C2H4O3 | |
| Centroid | |
| Isabel Meister, Romanas Chaleckis | |
| Agilent 6550 iFunnel | |
| LC-ESI-QTOF | |
| CC-BY | |
| MS2 | |
| ESI | |
| DDA | |
| Merck SeQuant ZIC pHILIC Guard column (2.1 mm x 20 mm, 5 µm particle size) with Merck SeQuant ZIC pHILIC (2.1 x 100 mm, 5 µm particle size, 100 Å) | |
| 12/88 at 0 min, 40/60 at 8.5 min, 75/25 at 8.7-11.2 min; 12/88 at 11.5-22 min | |
| 0.28ml/min | |
| 5 mM ammonium acetate in water with 0.04% NH4OH (pH 9.3) | |
| acetonitrile | |
| NEG_2020-11-24_V01B_RCH_LC06_tDDA_ChemSTD_219_CPD_Meister2020_OPEN.msp | |
| negative | |
| 0.6808229212848604 | |
| 0.4911099261306026 | |
| 75.0087661743164 | |
| [M-H]- | |
| 0.024179621589442826 ppm | |
| -1.8136835819859698E-6 Da |