Name | Value |
---|---|
InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 | |
RHGKLRLOHDJJDR-BYPYZUCNSA-N | |
C6H13N3O3 | |
175.095691276 | |
O=C(O)C(N)CCCNC(=N)O |
Name | Value |
---|---|
[M+H]+ | |
9.272765 | |
0 | |
C6H13N3O3 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
1.670965448769957 | |
0.6968467170878241 | |
176.102966308594 | |
3.9463696754161366 ppm | |
-6.949674059910649E-4 Da |