Name | Value |
---|---|
InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/t12-/m0/s1 | |
DZTHIGRZJZPRDV-LBPRGKRZSA-N | |
C13H14N2O3 | |
246.10044230799997 | |
O=C(O)C(N=C(O)C)CC1=CNC=2C=CC=CC21 |
Name | Value |
---|---|
1.650107 | |
30 | |
C13H14N2O3 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
2.904601325330137 | |
0.810544432780793 | |
247.107727050781 | |
[M+H]+ | |
2.773111254569954 ppm | |
-6.852572189757211E-4 Da |