Name | Value |
---|---|
InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8?/m1/s1 | |
OVRNDRQMDRJTHS-KEWYIRBNSA-N | |
C8H15NO6 | |
221.08993719999998 | |
OC(=NC1C(O)OC(CO)C(O)C1O)C |
Name | Value |
---|---|
6.29 | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
30 | |
C8H15NO6 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
2.863955580108502 | |
0.9133984574294034 | |
222.097213745117 | |
[M+H]+ | |
3.12230338822528 ppm | |
-6.93454882991773E-4 Da |