| Name | Value |
|---|---|
| InChI=1S/C10H11NO3/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14) | |
| UTYVDVLMYQPLQB-UHFFFAOYSA-N | |
| C10H11NO3 | |
| 193.073893212 | |
| O=C(O)CN=C(O)CC=1C=CC=CC1 |
| Name | Value |
|---|---|
| [M+H]+ | |
| 1.47 | |
| 10 | |
| C10H11NO3 | |
| Centroid | |
| Isabel Meister, Romanas Chaleckis | |
| Agilent 6550 iFunnel | |
| LC-ESI-QTOF | |
| CC-BY | |
| MS2 | |
| ESI | |
| DDA | |
| Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
| 5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
| 0.3ml/min | |
| water with 0.1% formic acid (pH2.7) | |
| acetonitrile with 0.1% formic acid | |
| POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
| positive | |
| 1.1085213837542167 | |
| 0.6887630614328566 | |
| 194.081176757813 | |
| 3.5369436565546275 ppm | |
| -6.864541869902041E-4 Da |