Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O5/c1-14(4-5-20(27)28)24(29)11-8-18-21-17(7-10-23(18,24)3)22(2)9-6-16(25)12-15(22)13-19(21)26/h14-19,21,25-26,29H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17+,18+,19-,21-,22+,23+,24+/m1/s1 | |
JSIQROACCRQDKK-GUDITCNYSA-N | |
C24H40O5 | |
408.28757437999997 | |
O=C(O)CCC(C)C1(O)CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC21C |
External Identifier | Value |
---|---|
4447245 | |
BBA0698 | |
5284157 |
Name | Value |
---|---|
NU000648 | |
2018.02.21 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
408.28757 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
ESI | |
80 C | |
-90 V | |
100-1000 | |
negative | |
2.738123661449742 | |
0.7900554855428548 |