Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H34O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29)/t13-,14-,16-,17+,18+,22+,23+,24-/m1/s1 | |
OHXPGWPVLFPUSM-NHJLYVEHSA-N | |
C24H34O5 | |
402.24062418799997 | |
O=C(O)CCC(C)C1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)C12C |
External Identifier | Value |
---|---|
4447208 | |
BBA0659 | |
5284120 |
Name | Value |
---|---|
NU000737 | |
2018.02.26 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
402.24063 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
ESI | |
80 C | |
-60 V | |
100-1000 | |
negative | |
2.3723957615531672 | |
0.8207926039520881 |