Name | Value |
---|---|
Natural Product | |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 | |
OUYCCCASQSFEME-QMMMGPOBSA-N | |
C9H11NO3 | |
181.073893212 | |
O=C(O)C(N)CC1=CC=C(O)C=C1 |
Name | Value |
---|---|
OUF01017 | |
2016.01.19 (Created 2013.05.09) | |
Dempo Y, Bamba T, Fukusaki E, engineering department, Osaka Univ. | |
CC BY-SA | |
Funkusaki Lab. in Osaka Univ. | |
The chemical compound was chemically modified with tert-butyldimethylsilyl-choloride (TBMSC) before GC-MS analysis. When it has two or more functional groups, this modification gave a mixture of the TMS derivatives having different number of TMS groups at different functional groups. | |
181.07389 | |
Agilent 7000B QqQMS, Agilent; Agilent 7907A series GC system, Agilent Technologies | |
GC-EI-QQ | |
MS1 | |
1 ml/min | |
200 C | |
50-600 | |
CP-SIL 8 CB LOW BLEED/MS | |
HELIUM 1 ml/min | |
230 C | |
80 C (Duration 2 min)-330 C (rate: 15 C/min; Duration 6 min) | |
2622.02 | |
984.36 sec | |
250 C | |
C27H56NO3Si3 | |
526.35679 | |
3 TBDMS | |
MassHunter (Agilent) | |
positive | |
3.162837756014885 | |
0.6209251791565958 |