Name | Value |
---|---|
Amino acids | |
InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 | |
HNDVDQJCIGZPNO-YFKPBYRVSA-N | |
C6H9N3O2 | |
155.069476528 | |
O=C(O)C(N)CC1=CN=CN1 |
External Identifier | Value |
---|---|
71-00-1 | |
6038 | |
C00135 | |
C00001363 | |
6274 |
Name | Value |
---|---|
PR100028 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
155.06948 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
30 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.7948035690911144 | |
0.723461386049746 | |
156.07727 | |
[M+H]+ | |
1.1310295214494306 ppm | |
-1.7652799999723356E-4 Da |