Name | Value |
---|---|
Natural Product; Nucleoside; Phosphates | |
InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 | |
XTWYTFMLZFPYCI-KQYNXXCUSA-N | |
C10H15N5O10P2 | |
427.0294149399999 | |
O=P(O)(O)OP(=O)(O)OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
External Identifier | Value |
---|---|
58-64-0 | |
5800 | |
C00008 | |
C00019353 | |
6022 |
Name | Value |
---|---|
PR100514 | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
427.02941 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
negative | |
1.3730428862670219 | |
0.9904410814726508 | |
426.02162 | |
[M-H]- | |
1.218107193596073 ppm | |
-5.189399999494526E-4 Da |