Name | Value |
---|---|
Flavin | |
InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 | |
AUNGANRZJHBGPY-SCRDCRAPSA-N | |
C17H20N4O6 | |
376.13828435999994 | |
O=C1N=C(O)C2=NC3=CC(=C(C=C3N(C2=N1)CC(O)C(O)C(O)CO)C)C |
External Identifier | Value |
---|---|
83-88-5 | |
431981 | |
C00255 | |
C00001552 | |
493570 |
Name | Value |
---|---|
376.13828 | |
PR100856 | |
2016.01.19 (Created 2010.06.21, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
negative | |
1.1273515039086848 | |
0.7004628729067827 | |
375.13048 | |
[M-H]- | |
1.4084699275187973 ppm | |
-5.283599999756916E-4 Da |