Name | Value |
---|---|
InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 | |
VOXZDWNPVJITMN-ZBRFXRBCSA-N | |
C18H24O2 | |
272.177630008 | |
OC1=CC=C2C(=C1)CCC3C2CCC4(C)C(O)CCC34 |
External Identifier | Value |
---|---|
50-28-2 | |
16469 | |
D00105 | |
LMST02010001 | |
5757 | |
5554 |
Name | Value |
---|---|
positive | |
UF414901 | |
2019-11-08 wrong annotation | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
272.1776 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
24.434 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
2.027109186857192 | |
0.7903115829403233 | |
273.1849 | |
[M+H]+ | |
2.5623963841597983 ppm | |
-7.000079999670561E-4 Da |