Name | Value |
---|---|
Natural Product; Fungal metabolite | |
C32H36N2O5 | |
528.262422252 | |
O=C1C=CC(=O)C23C(O)=NC(CC4=CNC=5C=CC=CC54)C3C(C)C6(OC6C2C=CCC(C=C(C)C1O)C)C | |
InChI=1S/C32H36N2O5/c1-17-8-7-10-22-29-31(4,39-29)19(3)27-24(15-20-16-33-23-11-6-5-9-21(20)23)34-30(38)32(22,27)26(36)13-12-25(35)28(37)18(2)14-17/h5-7,9-14,16-17,19,22,24,27-29,33,37H,8,15H2,1-4H3,(H,34,38)/t17-,19-,22-,24-,27-,28+,29-,31+,32+/m0/s1 | |
OUMWCYMRLMEZJH-RRFIZBDMSA-N |
External Identifier | Value |
---|---|
50335-03-0 | |
6438437 | |
4942914 | |
C00011307 |
Name | Value |
---|---|
AC000086 | |
2017.07.07 | |
CC BY-SA | |
Justin B. Renaud, J. David Miller, Mark W. Sumarah, Agriculture and Agri-Food Canada | |
Copyright (C) 2017 | |
Renaud, J. B.; Sumarah, M. W. Data Independent Acquisition-Digital Archiving Mass Spectrometry: Application to Single Kernel Mycotoxin Analysis of Fusarium Graminearum Infected Maize. Analytical and Bioanalytical Chemistry 2016, 408 (12), 3083–91. DOI:10.1007/s00216-016-9391-5 | |
CONFIDENCE isolated standard | |
528.26243 | |
Q-Exactive Orbitrap Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
3.9 kV | |
HCD | |
20(NCE) | |
17500 | |
Agilent RRHD Eclipse 50 x 2 mm, 1.8 uM | |
100:0 at 0 min, 100:0 at 0.5 min, 0:100 at 3.5 min, 0:100 at 5.5 min, 100:0 at 7 min | |
0.3 mL min-1 | |
3.68 | |
1236 | |
H2O 0.1% FA | |
ACN 0.1% FA | |
Proteowizard | |
based on Fragment ion formula determination | |
CUTOFF 0.05 Base Peak | |
positive | |
0.0 | |
NaN | |
551.2511 | |
[M+Na]+ | |
1.9814055700477196 ppm | |
-0.0010922520000349323 Da |