Name | Value |
---|---|
Natural Product; Fungal metabolite | |
InChI=1S/C15H26O2/c1-13(2)6-5-7-14(3)10-9(16)8-15(14,4)12(17)11(10)13/h9-12,16-17H,5-8H2,1-4H3/t9-,10+,11+,12?,14-,15-/m1/s1 | |
VWMGBHVRRNKOAE-PDMNRUCYSA-N | |
C15H26O2 | |
238.193280072 | |
OC1CC2(C)C(O)C3C1C2(C)CCCC3(C)C |
External Identifier | Value |
---|---|
18374-83-9 | |
115285 | |
327532 | |
C00021971 |
Name | Value |
---|---|
AC000096 | |
2017.07.07 | |
Justin B. Renaud, J. David Miller, Mark W. Sumarah, Agriculture and Agri-Food Canada | |
CC BY-SA | |
Copyright (C) 2017 | |
Renaud, J. B.; Sumarah, M. W. Data Independent Acquisition-Digital Archiving Mass Spectrometry: Application to Single Kernel Mycotoxin Analysis of Fusarium Graminearum Infected Maize. Analytical and Bioanalytical Chemistry 2016, 408 (12), 3083–91. DOI:10.1007/s00216-016-9391-5 | |
CONFIDENCE isolated standard | |
238.1933 | |
Q-Exactive Orbitrap Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
3.9 kV | |
HCD | |
20(NCE) | |
17500 | |
Agilent RRHD Eclipse 50 x 2 mm, 1.8 uM | |
100:0 at 0 min, 100:0 at 0.5 min, 0:100 at 3.5 min, 0:100 at 5.5 min, 100:0 at 7 min | |
0.3 mL min-1 | |
3.53 | |
1147 | |
H2O 0.1% FA | |
ACN 0.1% FA | |
Proteowizard | |
based on Fragment ion formula determination | |
CUTOFF 0.05 Base Peak | |
positive | |
2.163991543103032 | |
0.7990958004479609 | |
239.2 | |
[M+H]+ | |
5.226053511725838 ppm | |
-0.0012500720000048204 Da |