Name | Value |
---|---|
Natural Product; Fungal metabolite | |
InChI=1S/C20H20N2O9/c1-28-13-5-3-9-7-10(19(26)30-15(9)16(13)29-2)21-18(25)11-8-20(27)14(24)6-4-12(23)17(20)31-22-11/h3-7,12,14,17,23-24,27H,8H2,1-2H3,(H,21,25)/t12-,14-,17+,20+/m1/s1 | |
ZQOKLOPATOTAEE-OVCSSCHWSA-N | |
C20H20N2O9 | |
432.11688022 | |
O=C1OC=2C(OC)=C(OC)C=CC2C=C1NC(=O)C3=NOC4C(O)C=CC(O)C4(O)C3 |
External Identifier | Value |
---|---|
10982906 | |
9158107 | |
C00045116 |
Name | Value |
---|---|
AC000840 | |
2017.07.07 | |
Megan J. Kelman, Justin B. Renaud, Mark W. Sumarah, Agriculture and Agri-Food Canada | |
CC BY-SA | |
Copyright (C) 2017 | |
Visagie, C. M.; Renaud, J. B.; Burgess, K. M. N.; Malloch, D. W.; Clark, D.; Ketch, L.; Urb, M.; Louis-Seize, G.; Assabgui, R.; Sumarah, M. W.; et al. Fifteen New Species of Penicillium. Persoonia - Molecular Phylogeny and Evolution of Fungi 2016, 36 (1), 247–80. DOI:10.3767/003158516x691627 | |
CONFIDENCE Penicillium corvianum | |
432.11685 | |
Q-Exactive Orbitrap Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
3.9 kV | |
HCD | |
40(NCE) | |
17500 | |
Agilent RRHD Eclipse 50 x 2 mm, 1.8 uM | |
100:0 at 0 min, 100:0 at 0.5 min, 0:100 at 3.5 min, 0:100 at 5.5 min, 100:0 at 7 min | |
0.3 mL min-1 | |
2.8 | |
731 | |
H2O 0.1% FA | |
ACN 0.1% FA | |
Proteowizard | |
based on Fragment ion formula determination | |
CUTOFF 0.05 Base Peak | |
positive | |
2.564834751837554 | |
0.8297636769921892 | |
433.1236 | |
[M+H]+ | |
2.886520152617944 ppm | |
-0.0012502199999744334 Da |