Name | Value |
---|---|
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) | |
DKYWVDODHFEZIM-UHFFFAOYSA-N | |
C16H14O3 | |
254.094294308 | |
O=C(O)C(C=1C=CC=C(C1)C(=O)C=2C=CC=CC2)C |
External Identifier | Value |
---|---|
56105-81-8 | |
6128 | |
C01716 | |
3825 | |
3693 |
Name | Value |
---|---|
AU115006 | |
2019.05.30 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
254.0942943 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 20.0-30.0 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
8.641 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.7304635922466394 | |
0.5776429380966349 | |
255.1016 | |
[M+H]+ | |
2.604091859916658 ppm | |
-6.643080000117152E-4 Da |