Name | Value |
---|---|
InChI=1S/C7H7N3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H3,8,9,10) | |
JWYUFVNJZUSCSM-UHFFFAOYSA-N | |
C7H7N3 | |
133.063997224 | |
N=C1NC=2C=CC=CC2N1 |
External Identifier | Value |
---|---|
13624 | |
934-32-7 | |
27822 | |
13035 |
Name | Value |
---|---|
AU200310 | |
2016.02.26 | |
Nikiforos Alygizakis, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2016 Department of Chemistry, University of Athens | |
133.0639972 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
40 eV | |
35000 | |
ACQUITY UPLC BEH Amide 1.7 um 2.1x100mm, Waters | |
0/100 at 0-2 min, 95/5 at 12 min, 95/5 at 17 min, 0/100 at 17.1, 0/100 at 25 min | |
200 uL/min | |
6.582 min | |
Water with 0.01% formic acid and 1mM ammonium formate | |
Acetonitrile:WATER 95:5 with 0.01% formic acid and 1mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 1.99.10 | |
positive | |
1.0901484484425892 | |
0.6084234335941635 | |
134.0713 | |
[M+H]+ | |
4.976635566172476 ppm | |
-6.672239999829799E-4 Da |