Name | Value |
---|---|
InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3 | |
BYPFEZZEUUWMEJ-UHFFFAOYSA-N | |
C13H18N4O3 | |
278.13789043599996 | |
O=C1C2=C(N=CN2C)N(C(=O)N1CCCCC(=O)C)C |
External Identifier | Value |
---|---|
6493-05-6 | |
7986 | |
C07424 | |
4740 | |
4578 |
Name | Value |
---|---|
AU226706 | |
2018.12.19 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2018 Department of Chemistry, University of Athens | |
278.1378904 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 20.8-31.3 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
5.346 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.0 | |
positive | |
0.9796892074849177 | |
0.4254736167908697 | |
279.1452 | |
[M+H]+ | |
2.3659228243063524 ppm | |
-6.604359999755616E-4 Da |