Name | Value |
---|---|
InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18) | |
WIIZWVCIJKGZOK-UHFFFAOYSA-N | |
C11H12Cl2N2O5 | |
322.012326844 | |
O=N(=O)C1=CC=C(C=C1)C(O)C(N=C(O)C(Cl)Cl)CO |
External Identifier | Value |
---|---|
56-75-7 | |
94390 | |
298 | |
292 |
Name | Value |
---|---|
323.0196 | |
AU230606 | |
2019.04.08 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
322.0123268 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 22.1-33.1 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
5.766 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
2.0038417732801506 | |
0.9119876929965373 | |
[M+H]+ | |
2.157280858334448 ppm | |
-6.968439999468501E-4 Da |