Name | Value |
---|---|
InChI=1S/C9H9Cl2NO/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13) | |
LFULEKSKNZEWOE-UHFFFAOYSA-N | |
C9H9Cl2NO | |
217.006119268 | |
ClC1=CC=C(N=C(O)CC)C=C1Cl |
External Identifier | Value |
---|---|
709-98-8 | |
34936 | |
C14229 | |
4933 | |
4764 |
Name | Value |
---|---|
AU233104 | |
2019.05.30 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
217.0061193 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
40 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
9.396 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
0.9104004434076154 | |
0.4678532787598596 | |
218.0134 | |
[M+H]+ | |
3.161585480535279 ppm | |
-6.892680000021301E-4 Da |