Name | Value |
---|---|
180.07864424399997 | |
InChI=1S/C10H12O3/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 | |
QELSKZZBTMNZEB-UHFFFAOYSA-N | |
C10H12O3 | |
O=C(OCCC)C1=CC=C(O)C=C1 |
External Identifier | Value |
---|---|
94-13-3 | |
32063 | |
D01422 | |
7175 | |
6907 |
Name | Value |
---|---|
2019.05.30 | |
AU237206 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
180.0786442 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 17.2-25.8 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
8.322 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
0.7903741817194615 | |
0.5701344562066698 | |
181.0859 | |
[M+H]+ | |
3.9442275735739067 ppm | |
-7.142439999654471E-4 Da |