Name | Value |
---|---|
InChI=1S/C14H16N2O2/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2/h3-8H,15-16H2,1-2H3 | |
JRBJSXQPQWSCCF-UHFFFAOYSA-N | |
C14H16N2O2 | |
244.121177752 | |
O(C=1C=C(C=CC1N)C2=CC=C(N)C(OC)=C2)C |
External Identifier | Value |
---|---|
119-90-4 | |
82321 | |
C19231 | |
8411 | |
8104 |
Name | Value |
---|---|
AU242705 | |
2019.04.05 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
244.1211778 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
50 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
5.513 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
2.335043610226933 | |
0.6621681458622551 | |
245.1285 | |
[M+H]+ | |
2.642499750097997 ppm | |
-6.477519999918968E-4 Da |