Name | Value |
---|---|
InChI=1S/C9H7NO/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6H,(H,10,11) | |
LISFMEBWQUVKPJ-UHFFFAOYSA-N | |
C9H7NO | |
145.052763844 | |
OC=1N=C2C=CC=CC2=CC1 |
External Identifier | Value |
---|---|
59-31-4 | |
16365 | |
C06338 | |
6038 | |
5816 |
Name | Value |
---|---|
AU249105 | |
2019.04.08 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
145.0527638 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
50 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
4.073 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
0.6313232984505998 | |
0.9108069918723433 | |
146.06 | |
[M+H]+ | |
5.024264001064923 ppm | |
-7.338439999955426E-4 Da |