Name | Value |
---|---|
InChI=1S/C11H8ClNO2/c1-6-4-7-2-3-8(12)9(11(14)15)10(7)13-5-6/h2-5H,1H3,(H,14,15) | |
ALZOLUNSQWINIR-UHFFFAOYSA-N | |
C11H8ClNO2 | |
221.024356176 | |
O=C(O)C1=C(Cl)C=CC2=CC(=CN=C21)C |
External Identifier | Value |
---|---|
90717-03-6 | |
84199 | |
C18891 | |
91749 | |
82847 |
Name | Value |
---|---|
AU255202 | |
2019.05.29 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
221.0243562 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
20 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
4.891 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.2530421943954508 | |
0.5042612745643198 | |
222.0316 | |
[M+H]+ | |
3.2705975185540166 ppm | |
-7.261760000005779E-4 Da |