Name | Value |
---|---|
InChI=1S/C11H18N4O2/c1-7-8(2)12-10(14(3)4)13-9(7)17-11(16)15(5)6/h1-6H3 | |
YFGYUFNIOHWBOB-UHFFFAOYSA-N | |
C11H18N4O2 | |
238.142975816 | |
O=C(OC=1N=C(N=C(C1C)C)N(C)C)N(C)C |
External Identifier | Value |
---|---|
23103-98-2 | |
8248 | |
C11079 | |
31645 | |
29348 |
Name | Value |
---|---|
AU257703 | |
2019.05.29 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
238.1429758 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
30 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
7.724 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.5862715809632029 | |
0.5857615122192235 | |
239.1503 | |
[M+H]+ | |
2.7004607562785483 ppm | |
-6.458160000022417E-4 Da |