Name | Value |
---|---|
InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) | |
DSKJPMWIHSOYEA-UHFFFAOYSA-N | |
C13H24N4O3S | |
316.156911628 | |
O=S(=O)(OC1=NC(=NCC)NC(=C1CCCC)C)N(C)C |
External Identifier | Value |
---|---|
58694-46-5 | |
81952 | |
C18776 | |
38884 | |
35588 |
Name | Value |
---|---|
AU258506 | |
2019.05.31 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
316.1569116 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 21.9-32.9 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
10.536 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
3.246650432958903 | |
0.745207118976974 | |
317.1642 | |
[M+H]+ | |
2.149132846630456 ppm | |
-6.816279999952712E-4 Da |