Name | Value |
---|---|
InChI=1S/C41H65NO10/c1-10-26-12-11-13-34(52-36-17-16-33(42(5)6)23(3)48-36)22(2)37(44)32-20-30-28(31(32)21-35(43)50-26)15-14-25-18-27(19-29(25)30)51-41-40(47-9)39(46-8)38(45-7)24(4)49-41/h14-15,20,22-31,33-34,36,38-41H,10-13,16-19,21H2,1-9H3/t22-,23-,24+,25-,26+,27-,28-,29-,30-,31+,33+,34+,36+,38+,39-,40-,41+/m1/s1 | |
SRJQTHAZUNRMPR-UYQKXTDMSA-N | |
C41H65NO10 | |
731.4608472799999 | |
O=C1OC(CC)CCCC(OC2OC(C)C(N(C)C)CC2)C(C(=O)C3=CC4C(C=CC5CC(OC6OC(C)C(OC)C(OC)C6OC)CC54)C3C1)C |
External Identifier | Value |
---|---|
131929-60-7 | |
9230 | |
C11054 | |
443059 | |
391358 |
Name | Value |
---|---|
AU263505 | |
2019.05.30 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
731.4608473 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
50 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
11.178 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.0643890580322173 | |
0.3930462801609061 | |
732.4681 | |
[M+H]+ | |
0.9792644893201453 ppm | |
-7.172799998897972E-4 Da |