Name | Value |
---|---|
InChI=1S/C18H31NO4/c1-14(2)19-11-17(20)13-23-18-7-5-16(6-8-18)12-21-9-10-22-15(3)4/h5-8,14-15,17,19-20H,9-13H2,1-4H3 | |
VHYCDWMUTMEGQY-UHFFFAOYSA-N | |
C18H31NO4 | |
325.225308472 | |
OC(COC1=CC=C(C=C1)COCCOC(C)C)CNC(C)C |
External Identifier | Value |
---|---|
66722-44-9 | |
3127 | |
C06852 | |
2405 | |
2312 |
Name | Value |
---|---|
AU267704 | |
2019.05.30 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
325.2253085 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
40 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
5.766 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
2.696979244211767 | |
0.7468957504594191 | |
326.2326 | |
[M+H]+ | |
2.079718581172295 ppm | |
-6.784720000041489E-4 Da |