Name | Value |
---|---|
InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3 | |
VYVKHNNGDFVQGA-UHFFFAOYSA-N | |
C25H35NO5 | |
429.25152322 | |
O=C(OCCCCN(CC)C(C)CC1=CC=C(OC)C=C1)C2=CC=C(OC)C(OC)=C2 |
External Identifier | Value |
---|---|
3625-06-7 | |
91514 | |
D08160 | |
4031 | |
3891 |
Name | Value |
---|---|
2019.05.30 | |
AU274402 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
429.2515232 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
20 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
6.680 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.331156888017565 | |
0.6058356081340479 | |
430.2588 | |
[M+H]+ | |
1.6111698354954767 ppm | |
-6.932200000164812E-4 Da |