Name | Value |
---|---|
InChI=1S/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24) | |
SGUAFYQXFOLMHL-UHFFFAOYSA-N | |
C19H24N2O3 | |
328.17869262799996 | |
N=C(O)C1=CC(=CC=C1O)C(O)CNC(C)CCC=2C=CC=CC2 |
External Identifier | Value |
---|---|
83167-24-2 | |
6343 | |
C07063 | |
3869 | |
3734 |
Name | Value |
---|---|
AU275701 | |
2019.05.30 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
328.1786926 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
10 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
5.594 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
1.3138114077683767 | |
0.570581044655349 | |
329.186 | |
[M+H]+ | |
2.0129288608458387 ppm | |
-6.626279999863982E-4 Da |