Name | Value |
---|---|
InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 | |
RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
C8H10N4O2 | |
194.08037556 | |
O=C1C2=C(N=CN2C)N(C(=O)N1C)C |
External Identifier | Value |
---|---|
58-08-2 | |
27732 | |
D00528 | |
2519 | |
2424 |
Name | Value |
---|---|
AU276603 | |
2019.05.31 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
194.0803756 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
30 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
6.637 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
0.0 | |
NaN | |
195.0877 | |
[M+H]+ | |
3.309075866807903 ppm | |
-6.455599999810602E-4 Da |