Name | Value |
---|---|
InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-6,8,10,14H,1,7,9H2 | |
PZBPKYOVPCNPJY-UHFFFAOYSA-N | |
C14H14Cl2N2O | |
296.04831842799996 | |
ClC1=CC=C(C(Cl)=C1)C(OCC=C)CN2C=NC=C2 |
External Identifier | Value |
---|---|
35554-44-0 | |
83829 | |
C18739 | |
37175 | |
34116 |
Name | Value |
---|---|
AU285806 | |
2019.05.31 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
296.0483184 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
Ramp 20-30 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
8.645 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
2.8820671708346133 | |
0.7330099144904489 | |
297.0556 | |
[M+H]+ | |
2.317505544189802 ppm | |
-6.884279999326282E-4 Da |