Name | Value |
---|---|
InChI=1S/C8H12INO2/c1-2-3-6-10-8(11)12-7-4-5-9/h2-3,6-7H2,1H3,(H,10,11) | |
WYVVKGNFXHOCQV-UHFFFAOYSA-N | |
C8H12INO2 | |
280.99127662399997 | |
IC#CCOC(O)=NCCCC |
External Identifier | Value |
---|---|
55406-53-6 | |
83279 | |
62097 | |
55933 |
Name | Value |
---|---|
2019.05.31 | |
AU286802 | |
Nikiforos Alygizakis, Katerina Galani, Nikolaos Thomaidis, University of Athens | |
CC BY | |
Copyright (C) 2019 Department of Chemistry, University of Athens | |
280.9912766 | |
Bruker maXis Impact | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
20 eV | |
35000 | |
Acclaim RSLC C18 2.2um, 2.1x100mm, Thermo | |
99/1 at 0-1 min, 61/39 at 3 min, 0.1/99.9 at 14-16 min, 99/1 at 16.1-20 min | |
200 uL/min at 0-3 min, 400 uL/min at 14 min, 480 uL/min at 16-19 min, 200 uL/min at 19.1-20 min | |
8.045 min | |
90:10 water:methanol with 0.01% formic acid and 5mM ammonium formate | |
methanol with 0.01% formic acid and 5mM ammonium formate | |
identity on assigned fragments and MS1 | |
RMassBank 2.10.1 | |
positive | |
0.16448928941349736 | |
0.14972460358413986 | |
281.9986 | |
[M+H]+ | |
2.2930042913525424 ppm | |
-6.466239999554091E-4 Da |