Name | Value |
---|---|
InChI=1S/C23H22O7/c1-11(9-24)16-7-14-15(29-16)5-4-12-22(25)21-13-6-18(26-2)19(27-3)8-17(13)28-10-20(21)30-23(12)14/h4-6,8,16,20-21,24H,1,7,9-10H2,2-3H3/t16-,20-,21+/m1/s1 | |
ZJMLELXRQUXRIU-HBGVWJBISA-N | |
C23H22O7 | |
410.136553044 | |
O=C1C2=CC=C3OC(C(=C)CO)CC3=C2OC4COC5=CC(OC)=C(OC)C=C5C14 |
External Identifier | Value |
---|---|
4208-09-7 | |
3546693 | |
92207 |
Name | Value |
---|---|
BML00231 | |
2016.01.19 (Created 2012.10.26) | |
Cuthbertson DJ, Johnson SR, Lange BM, Institute of Biological Chemistry, Washington State University | |
CC BY-SA | |
0.6 ml/min | |
relative retention time with respect to 9-anthracene Carboxylic Acid is 1.088 | |
410.136553 | |
Agilent 1200 RRLC; Agilent 6520 QTOF | |
LC-ESI-QTOF | |
MS2 | |
40 ev | |
N2 | |
m/z 100-1000 | |
Agilent C8 Cartridge Column 2.1X30mm 3.5 micron (guard); Agilent SB-Aq 2.1x50mm 1.8 micron (analytical) | |
60 C | |
linear from 98A/2B at 0 min to 2A/98B at 13 min, hold 6 min at 2A/98B, reequilibration 98A/2B (5 min) | |
8.024 | |
water with 0.2% acetic acid | |
methanol with 0.2% acetic acid | |
negative | |
3.0170235110857084 | |
0.6809181349753204 | |
409.1293 | |
[M-H]- | |
0.05610940113393072 ppm | |
2.295600000934428E-5 Da |